57160-78-8 Usage
General Description
1H-Benzimidazole,2-fluoro-(9CI) is a chemical compound with the molecular formula C7H5FN2. It is a member of the benzimidazole class of compounds, which are known for their diverse range of biological activities. This specific compound contains a fluorine atom attached to the benzimidazole ring, which can alter its physicochemical and biological properties. 1H-Benzimidazole,2-fluoro-(9CI) may have potential applications in the pharmaceutical industry, particularly in the development of new drugs with therapeutic properties. Further research is needed to explore its specific uses and potential benefits in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 57160-78-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,6 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 57160-78:
(7*5)+(6*7)+(5*1)+(4*6)+(3*0)+(2*7)+(1*8)=128
128 % 10 = 8
So 57160-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)