5719-46-0 Usage
General Description
4-chloro-5,7-dihydro-2-methylthieno[3,4-d]pyrimidine is a chemical compound with the molecular formula C6H6ClN3S. It is a heterocyclic compound containing a thieno pyrimidine ring with a chlorine atom and a methyl group attached to it. 4-chloro-5,7-dihydro-2-methylthieno[3,4-d]pyrimidine is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. Its heterocyclic nature and functional groups make it a valuable intermediate for the production of various bioactive compounds. Additionally, it has demonstrated potential biological activities, such as antimicrobial and antiviral properties, making it a significant target for medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 5719-46-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,1 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5719-46:
(6*5)+(5*7)+(4*1)+(3*9)+(2*4)+(1*6)=110
110 % 10 = 0
So 5719-46-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN2S/c1-4-9-6-3-11-2-5(6)7(8)10-4/h2-3H2,1H3
5719-46-0Relevant articles and documents
Pyrimidine ortho-quinodimethanes
Tome, Augusto C.,Cavaleiro, Jose A.S.,Storr, Richard C.
, p. 1735 - 1746 (2007/10/03)
The pyrimidine sulfones 10, R = Me; Nu = OMe, NEt2, SPh, H and 11, R = Ph; Nu = OMe were synthesised from the dihydrothienopyrimidones 7, R = Me, Ph by conversion to the chloro derivatives 8 followed by oxidation with mCPBA and reaction with the appropriate nucleophile or hydrogen and Pd. Heating of the sulfones in 1,2,4-trichlorobenzene gave the pyrimidine o-quinodimethanes which were intercepted in Diels-Alder reactions to give tetrahydroquinazolines.
