57200-31-4 Usage
Description
S-Isopropylthiourea hydrobromide, with the molecular formula C6H14BrNS, is a hydrobromide salt derivative of S-isopropylthiourea, a thiourea derivative. It is a chemical compound that plays a significant role in pharmaceutical synthesis and research.
Uses
Used in Pharmaceutical Industry:
S-Isopropylthiourea hydrobromide is used as a pharmaceutical intermediate for the synthesis of various drugs, including antithyroid agents and cardiovascular drugs. Its unique chemical properties make it a valuable component in the development of these medications.
Used in Research and Laboratory Settings:
In research and laboratory settings, S-Isopropylthiourea hydrobromide serves as a reagent in organic synthesis and biochemistry. Its ability to participate in various chemical reactions and its stability contribute to its utility in these environments.
Used in Radioprotection Research:
S-Isopropylthiourea hydrobromide has been investigated for its potential role in protecting against radiation-induced damage. This makes it a topic of interest in the field of radioprotection, where it could potentially be used to mitigate the harmful effects of radiation exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 57200-31-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,0 and 0 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 57200-31:
(7*5)+(6*7)+(5*2)+(4*0)+(3*0)+(2*3)+(1*1)=94
94 % 10 = 4
So 57200-31-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H10N2S.BrH/c1-3(2)7-4(5)6;/h3H,1-2H3,(H3,5,6);1H
