57213-16-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-L-Phenylalanine is used as a building block for the synthesis of peptides and proteins, which are essential components of various biological processes and therapeutic agents. Its unique structural properties and potential biological activities make it a valuable compound in the development of new drugs and pharmaceutical formulations.
Used in Medicinal Chemistry:
3-Amino-L-Phenylalanine is utilized as a key component in the design and synthesis of novel compounds with potential therapeutic applications. Its unique structural features and ability to interact with various biological targets make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Drug Development:
3-Amino-L-Phenylalanine is employed in the research and development of new drugs and pharmaceuticals. Its potential biological activities and unique structural properties allow it to be a valuable tool in the discovery and optimization of novel therapeutic agents for the treatment of various disorders and diseases.
Used in Therapeutic Applications:
3-Amino-L-Phenylalanine is used as a potential therapeutic agent for the treatment of certain disorders. Its unique structural properties and potential biological activities have been studied for their ability to modulate various biological processes and pathways, offering new avenues for the development of targeted therapies and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 57213-16-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,1 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 57213-16:
(7*5)+(6*7)+(5*2)+(4*1)+(3*3)+(2*1)+(1*6)=108
108 % 10 = 8
So 57213-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13)
