5722-80-5 Usage
Uses
Used in Pharmaceutical Industry:
Cysteinesulfenic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical properties allow it to be a versatile building block for the development of new drugs with potential applications in treating different diseases.
Used in Biochemical Research:
Cysteinesulfenic acid serves as an important molecule in biochemical research, particularly in the study of protein structure and function. Its presence in proteins can help researchers understand the role of cysteine residues in various biological processes and their interactions with other molecules.
Used in Chemical Synthesis:
Cysteinesulfenic acid is used as a reagent in chemical synthesis, particularly in the preparation of other sulfur-containing compounds. Its unique S-hydroxy group can be exploited to form new chemical bonds and create a variety of products with diverse applications.
Used in Environmental Applications:
Cysteinesulfenic acid can be employed in environmental applications, such as the removal of heavy metals from contaminated water sources. Its sulfur-containing structure allows it to form stable complexes with metal ions, making it a potential candidate for environmental remediation processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5722-80-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,2 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5722-80:
(6*5)+(5*7)+(4*2)+(3*2)+(2*8)+(1*0)=95
95 % 10 = 5
So 5722-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C3H7NO3S/c4-2(1-8-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
