57232-94-7 Usage
Uses
Used in Organic Synthesis:
[1-ethylbenz[cd]indol-2(1H)-ylidene]malononitrile is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of molecules with diverse properties and applications.
Used in Pharmaceutical Production:
In the pharmaceutical industry, [1-ethylbenz[cd]indol-2(1H)-ylidene]malononitrile is used as a precursor for the development of new drugs. Its unique properties contribute to the design and synthesis of novel therapeutic agents with potential applications in various medical fields.
Used in Agrochemical Production:
Similarly, in the agrochemical sector, [1-ethylbenz[cd]indol-2(1H)-ylidene]malononitrile serves as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides, that are essential for agricultural productivity and crop protection.
Used in Fluorescence Spectroscopy and Analytical Chemistry:
The fluorescent properties of [1-ethylbenz[cd]indol-2(1H)-ylidene]malononitrile make it a valuable tool in the field of fluorescence spectroscopy and analytical chemistry. It can be employed as a marker or probe in various experimental setups, enabling the study of molecular interactions, detection of specific compounds, and monitoring of chemical reactions.
Overall, [1-ethylbenz[cd]indol-2(1H)-ylidene]malononitrile has a diverse range of applications across different industries, thanks to its unique chemical properties and versatile utility in synthesis and material development.
Check Digit Verification of cas no
The CAS Registry Mumber 57232-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,3 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57232-94:
(7*5)+(6*7)+(5*2)+(4*3)+(3*2)+(2*9)+(1*4)=127
127 % 10 = 7
So 57232-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H11N3/c1-2-19-14-8-4-6-11-5-3-7-13(15(11)14)16(19)12(9-17)10-18/h3-8H,2H2,1H3
