57262-38-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(2-Benzimidazolylamino)-1-ethanol 97 is utilized as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the attachment of various functional groups, enhancing the compound's versatility in medicinal chemistry.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2-(2-Benzimidazolylamino)-1-ethanol 97 is employed as a precursor in the production of pesticides and other agricultural chemicals. Its incorporation into these products can lead to improved efficacy and targeted pest control.
Used in Material Development:
2-(2-BENZIMIDAZOYLAMINO)-1-ETHANOL 97's structural properties also make it a candidate for the development of new materials with specific applications in various industries. Its potential use in material science is an area of ongoing research and development.
Used as a Reagent in Chemical Research and Development:
2-(2-Benzimidazolylamino)-1-ethanol 97 serves as a reagent in chemical research and development, aiding scientists in conducting experiments and discovering new chemical reactions and processes.
Used in Antifungal and Antibacterial Applications:
Studies have indicated that 2-(2-Benzimidazolylamino)-1-ethanol 97 possesses potential antifungal and antibacterial properties. This makes it a candidate for use in the development of antimicrobial agents, which could be applied in various settings, including medical, industrial, and environmental contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 57262-38-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,6 and 2 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 57262-38:
(7*5)+(6*7)+(5*2)+(4*6)+(3*2)+(2*3)+(1*8)=131
131 % 10 = 1
So 57262-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3O/c13-6-5-10-9-11-7-3-1-2-4-8(7)12-9/h1-4,13H,5-6H2,(H2,10,11,12)
