57278-46-3 Usage
Uses
Used in Pharmaceutical Industry:
7-CHLORO-4-HYDROXY-3-QUINOLINECARBOXYLIC ACID is used as a key intermediate in the synthesis of various drugs and pharmaceuticals. Its unique chemical structure and reactivity make it a valuable building block for the development of new therapeutic agents.
Used in Agrochemical Production:
In the agrochemical industry, 7-CHLORO-4-HYDROXY-3-QUINOLINECARBOXYLIC ACID is used as an intermediate in the production of various agrochemicals. Its versatile chemical structure allows for the creation of compounds with specific pesticidal or herbicidal properties.
Used in Dye Manufacturing:
7-CHLORO-4-HYDROXY-3-QUINOLINECARBOXYLIC ACID is also utilized in the dye manufacturing industry. Its chemical properties contribute to the development of dyes with unique color characteristics and stability, making it an important component in the formulation of various dye products.
Check Digit Verification of cas no
The CAS Registry Mumber 57278-46-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,7 and 8 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 57278-46:
(7*5)+(6*7)+(5*2)+(4*7)+(3*8)+(2*4)+(1*6)=153
153 % 10 = 3
So 57278-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNO3/c11-5-1-2-6-8(3-5)12-4-7(9(6)13)10(14)15/h1-4H,(H,12,13)(H,14,15)
