572923-01-4 Usage
Uses
Used in Pharmaceutical Industry:
(S)-4-ETHYL-3-(3-METHOXYPHENYL)OXAZOLIDIN-2-ONE is used as a potential candidate for the development of antibacterial drugs due to its unique structure and properties. Its ability to target specific biological processes and interact with biological receptors and enzymes makes it a valuable compound in the fight against bacterial infections.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (S)-4-ETHYL-3-(3-METHOXYPHENYL)OXAZOLIDIN-2-ONE is used for studying its interactions with biological receptors and enzymes. This research can lead to a better understanding of its potential applications in drug design and development, as well as contribute to the advancement of pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 572923-01:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*0)+(1*1)=164
164 % 10 = 4
So 572923-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c1-3-9-8-16-12(14)13(9)10-5-4-6-11(7-10)15-2/h4-7,9H,3,8H2,1-2H3/t9-/m0/s1
