572923-01-4 Usage
General Description
(S)-4-ethyl-3-(3-methoxyphenyl)oxazolidin-2-one is a chemical compound that belongs to the oxazolidinone class of compounds. It is a chiral molecule, meaning it has a specific three-dimensional arrangement of atoms that gives it a non-superimposable mirror image. (S)-4-ETHYL-3-(3-METHOXYPHENYL)OXAZOLIDIN-2-ONE has been studied for its potential pharmaceutical applications, particularly in the development of antibacterial drugs. Its unique structure and properties make it a promising candidate for targeting specific biological processes. Additionally, the presence of an ethyl group and a methoxyphenyl group in its structure suggests it may have interactions with biological receptors and enzymes, making it a valuable compound for medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 572923-01:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*0)+(1*1)=164
164 % 10 = 4
So 572923-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c1-3-9-8-16-12(14)13(9)10-5-4-6-11(7-10)15-2/h4-7,9H,3,8H2,1-2H3/t9-/m0/s1
