572923-06-9 Usage
General Description
"(S)-4-ethyl-3-p-tolyloxazolidin-2-one" is a chemical compound that belongs to the class of oxazolidinones. It is a chiral molecule with a specific stereochemistry. (S)-4-ETHYL-3-P-TOLYLOXAZOLIDIN-2-ONE has potential applications in medicinal chemistry, particularly in the development of new antibiotics. It is known for its inhibitory activity against bacterial ribosomal protein synthesis, making it a promising candidate for the treatment of various bacterial infections. Additionally, its unique structure and properties make it a valuable target for chemical synthesis and structure-activity relationship studies. Overall, "(S)-4-ethyl-3-p-tolyloxazolidin-2-one" has significant importance in pharmaceutical research and development, and its properties continue to be the subject of scientific interest and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-06-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 572923-06:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*0)+(1*6)=169
169 % 10 = 9
So 572923-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c1-3-10-8-15-12(14)13(10)11-6-4-9(2)5-7-11/h4-7,10H,3,8H2,1-2H3/t10-/m0/s1