572923-14-9 Usage
Uses
Used in Pharmaceutical Industry:
(S)-3-(3-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is used as a precursor in the synthesis of various drugs and pharmaceutical products. Its unique structure and properties make it a valuable building block for creating new compounds with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, (S)-3-(3-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is used as a key intermediate for the development of novel chemical compounds. Its reactivity and structural features facilitate the creation of a wide range of molecules with diverse applications.
Used in Medicinal Chemistry:
(S)-3-(3-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is utilized in medicinal chemistry for the design and synthesis of new pharmaceutical agents. Studies have shown that derivatives of (S)-3-(3-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE exhibit various pharmacological activities, making it an important target for the development of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 572923-14:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*1)+(1*4)=169
169 % 10 = 9
So 572923-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO3/c1-3-11-8-17-13(16)14(11)12-6-4-5-10(7-12)9(2)15/h4-7,11H,3,8H2,1-2H3/t11-/m0/s1
