572923-18-3 Usage
Uses
Used in Organic Synthesis:
(S)-3-(4-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is used as a building block for the synthesis of diverse organic compounds. Its unique structural features and ability to undergo various chemical reactions make it a valuable component in creating a wide range of molecules with different properties and applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (S)-3-(4-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is used as a starting material for the development of new pharmaceuticals. Its structural similarity to biologically active compounds allows researchers to explore its potential in designing and synthesizing novel drugs with improved efficacy and selectivity.
Used in Enzyme Inhibition:
(S)-3-(4-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE has been studied for its potential as an enzyme inhibitor. Its ability to interact with specific enzymes can be harnessed to develop drugs that modulate enzyme activity, which may be beneficial in treating various diseases and conditions.
Used in Therapeutic Applications:
As a potential drug candidate, (S)-3-(4-ACETYLPHENYL)-4-ETHYLOXAZOLIDIN-2-ONE is being investigated for its therapeutic applications in various areas of medicine. Its pharmacological properties, such as enzyme inhibition and structural similarities to biologically active compounds, make it a promising candidate for the development of new treatments for a range of diseases and disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-18-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 572923-18:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*1)+(1*8)=173
173 % 10 = 3
So 572923-18-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO3/c1-3-11-8-17-13(16)14(11)12-6-4-10(5-7-12)9(2)15/h4-7,11H,3,8H2,1-2H3/t11-/m0/s1
