572923-26-3 Usage
General Description
(S)-2-phenyl-2-p-tolylamino-ethanol is an organic compound that belongs to the class of amino alcohols. It consists of a phenyl group and a p-tolylamino group attached to a chiral carbon atom, giving it a stereocenter. (S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL is often used as a building block in the synthesis of various pharmaceuticals and fine chemicals. It has been studied for its potential use in the treatment of various medical conditions, such as neurological disorders and cardiovascular diseases. Additionally, it has been investigated for its potential role as a chiral ligand in asymmetric synthesis and catalysis. Its unique structure and properties make it a valuable molecule in the field of medicinal chemistry and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-26-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 572923-26:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*2)+(1*6)=173
173 % 10 = 3
So 572923-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c1-12-7-9-14(10-8-12)16-15(11-17)13-5-3-2-4-6-13/h2-10,15-17H,11H2,1H3/t15-/m1/s1
