57323-33-8 Usage
Uses
Used in Organic Synthesis:
2-(1-Chloroethyl)anthracene is used as a key intermediate in the synthesis of various organic compounds. Its unique chemical structure allows it to participate in a range of reactions, facilitating the creation of diverse molecules with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(1-Chloroethyl)anthracene is used as a building block for the development of new drugs. Its chemical properties make it suitable for the synthesis of molecules with potential therapeutic effects, contributing to the advancement of medical treatments.
Used in Chemical Research:
2-(1-Chloroethyl)anthracene is also utilized in chemical research as a model compound to study various reaction mechanisms and explore new synthetic pathways. This helps researchers gain a deeper understanding of chemical processes and develop innovative strategies for creating novel compounds.
Used in Dye and Pigment Industry:
The yellow powder form of 2-(1-Chloroethyl)anthracene makes it a potential candidate for use in the dye and pigment industry. Its color properties can be harnessed to create new dyes and pigments for various applications, such as in the textile, plastics, and printing industries.
Check Digit Verification of cas no
The CAS Registry Mumber 57323-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,3,2 and 3 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57323-33:
(7*5)+(6*7)+(5*3)+(4*2)+(3*3)+(2*3)+(1*3)=118
118 % 10 = 8
So 57323-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H13Cl/c1-11(17)12-6-7-15-9-13-4-2-3-5-14(13)10-16(15)8-12/h2-11H,1H3
