57470-54-9 Usage
Uses
Used in Pharmaceutical and Drug Development:
6-Hydroxyimidazo[1,2-b]pyridazine is utilized as a key intermediate in the synthesis of biologically active compounds. Its structural features make it a valuable component in the development of new pharmaceuticals with potential therapeutic applications.
Used in Industrial Chemistry:
This chemical compound serves as a building block in the production of dyes, agrochemicals, and other specialty chemicals. Its aromatic nature and fused rings contribute to the creation of diverse chemical products with specific properties.
Used in Materials Science:
6-Hydroxyimidazo[1,2-b]pyridazine might also find applications in the field of materials science, where it could be employed in the development of new materials with unique properties, such as high thermal stability or specific optical characteristics.
Used in Molecular Architecture:
As a versatile building block, 6-Hydroxyimidazo[1,2-b]pyridazine can be used in the construction of complex molecular architectures. Its potential in this area lies in its ability to form stable connections with other molecules, leading to the creation of intricate and functional molecular systems.
Check Digit Verification of cas no
The CAS Registry Mumber 57470-54-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,4,7 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57470-54:
(7*5)+(6*7)+(5*4)+(4*7)+(3*0)+(2*5)+(1*4)=139
139 % 10 = 9
So 57470-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3O/c10-6-2-1-5-7-3-4-9(5)8-6/h1-4H,(H,8,10)
