57543-39-2 Usage
Uses
Used in Pharmaceutical Industry:
7-Methoxy-2H-chromene-3-carbaldehyde is used as a pharmaceutical agent for its potential therapeutic applications. Its antifungal, antibacterial, and anticancer properties make it a promising candidate for the development of new drugs and therapies to treat various diseases and conditions.
Used in Antifungal Applications:
7-Methoxy-2H-chromene-3-carbaldehyde is used as an antifungal agent, exhibiting inhibitory activity against various fungal species. Its potential use in treating fungal infections and developing antifungal drugs is currently being explored.
Used in Antibacterial Applications:
7-METHOXY-2H-CHROMENE-3-CARBALDEHYDE is used as an antibacterial agent, showing inhibitory effects on bacterial growth and activity. Its potential role in developing new antibiotics and combating bacterial resistance is being investigated.
Used in Anticancer Applications:
7-Methoxy-2H-chromene-3-carbaldehyde is used as an anticancer agent, with research indicating its potential to inhibit various enzymes and cellular processes associated with cancer development and progression. Its role in the development of new cancer therapies and drugs is under investigation.
Used in Drug Development Research:
7-Methoxy-2H-chromene-3-carbaldehyde is used as a valuable chemical in drug development research. Its potential biological and pharmacological activities, along with its inhibitory effects on various enzymes and cellular processes, make it a promising candidate for the development of new drugs and therapies for a range of diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 57543-39-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,5,4 and 3 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 57543-39:
(7*5)+(6*7)+(5*5)+(4*4)+(3*3)+(2*3)+(1*9)=142
142 % 10 = 2
So 57543-39-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O3/c1-13-10-3-2-9-4-8(6-12)7-14-11(9)5-10/h2-6H,7H2,1H3
