57629-98-8 Usage
Chemical structure
A derivative of benzoic acid with a nitrosoamine group and a methyl ester group.
Laboratory research
Used as a potential carcinogen due to its nitrosamine moiety.
Genetic toxicology studies
Used as a test compound for its mutagenic properties.
Industrial processes
Formed as a byproduct in certain processes.
Carcinogenicity
Linked to the development of cancer in animal studies.
Mutagenicity
Known to be a potential mutagen.
Environmental hazards
Recognized as a photochemical pollutant.
Safety precautions
Use and handling should be carefully controlled and regulated due to potential health and environmental hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 57629-98-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,2 and 9 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 57629-98:
(7*5)+(6*7)+(5*6)+(4*2)+(3*9)+(2*9)+(1*8)=168
168 % 10 = 8
So 57629-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O3/c1-11(10-13)7-14-9(12)8-5-3-2-4-6-8/h2-6H,7H2,1H3
