57672-33-0 Usage
General Description
7-NITRO-2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBOXYLIC ACID is a chemical compound with a molecular formula C9H7NO6. It is a nitro-substituted derivative of 2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, which is commonly used in the synthesis of various pharmaceuticals. The compound has potential applications in the fields of medicinal chemistry and drug development due to its unique chemical structure and potential biological activities. It is important to handle and use this compound with caution, following proper safety protocols and guidelines, due to its potential health hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 57672-33-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,7 and 2 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57672-33:
(7*5)+(6*7)+(5*6)+(4*7)+(3*2)+(2*3)+(1*3)=150
150 % 10 = 0
So 57672-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO6/c11-9(12)5-3-7-8(16-2-1-15-7)4-6(5)10(13)14/h3-4H,1-2H2,(H,11,12)
