57693-77-3 Usage
Uses
Used in Chemical Synthesis:
ETHYLTETRAMETHYLCYCLOPENTADIENE is used as a key intermediate for the synthesis of various complex organic molecules. Its unique structure allows it to participate in multiple types of chemical reactions, making it a versatile building block in the creation of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, ETHYLTETRAMETHYLCYCLOPENTADIENE is used as a starting material for the development of novel drug candidates. Its ability to undergo a wide range of chemical transformations enables the synthesis of diverse molecular structures with potential therapeutic applications.
Used in Agrochemical Industry:
ETHYLTETRAMETHYLCYCLOPENTADIENE is also utilized in the agrochemical industry for the synthesis of new pesticides and other crop protection agents. Its reactivity and structural diversity contribute to the development of innovative products that can help address challenges in modern agriculture.
Used in Specialty Chemicals:
In the specialty chemicals sector, ETHYLTETRAMETHYLCYCLOPENTADIENE is employed as a crucial component in the production of various high-value chemicals. Its unique properties make it suitable for use in the synthesis of advanced materials, additives, and other specialty products that serve a wide range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 57693-77-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,9 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 57693-77:
(7*5)+(6*7)+(5*6)+(4*9)+(3*3)+(2*7)+(1*7)=173
173 % 10 = 3
So 57693-77-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H18/c1-6-11-9(4)7(2)8(3)10(11)5/h11H,6H2,1-5H3