57771-09-2 Usage
Uses
Used in Scientific Research:
4-(DIBUTYLAMINO)SALICYLALDEHYDE is used as a chemical compound for various scientific research applications. Its unique structure and properties make it valuable in the development and study of new chemical reactions and processes.
Safety Precautions:
4-(DIBUTYLAMINO)SALICYLALDEHYDE is used as a cautionary chemical for safety reasons due to its potential to cause skin, eye, and respiratory tract irritation. Proper handling and storage are essential to minimize risks associated with its use.
Storage Conditions:
4-(DIBUTYLAMINO)SALICYLALDEHYDE is used as a chemical requiring specific storage conditions to prevent degradation. Ensuring proper storage is crucial for maintaining the compound's stability and effectiveness in research applications.
Handling:
4-(DIBUTYLAMINO)SALICYLALDEHYDE is used as a chemical that necessitates careful handling, similar to other chemicals. Adhering to safety protocols and guidelines is vital to protect researchers and ensure the safe use of 4-(DIBUTYLAMINO)SALICYLALDEHYDE in scientific studies.
Check Digit Verification of cas no
The CAS Registry Mumber 57771-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,7,7 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 57771-09:
(7*5)+(6*7)+(5*7)+(4*7)+(3*1)+(2*0)+(1*9)=152
152 % 10 = 2
So 57771-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H23NO2/c1-3-5-9-16(10-6-4-2)14-8-7-13(12-17)15(18)11-14/h7-8,11-12,18H,3-6,9-10H2,1-2H3
