57774-76-2 Usage
Uses
Used in Organic Synthesis:
4-Ethyl-thiobenzamide is used as a key intermediate in the synthesis of various organic compounds. Its unique chemical structure allows for the formation of diverse products through reactions such as condensation, substitution, and rearrangement, making it a valuable component in the creation of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-ethyl-thiobenzamide is utilized as a reagent for the development of new drugs and pharmaceutical agents. Its ability to participate in various chemical reactions enables the synthesis of potential therapeutic compounds, contributing to the advancement of medicinal chemistry.
Used in the Preparation of Pharmaceutical Intermediates:
4-Ethyl-thiobenzamide plays a crucial role in the preparation of pharmaceutical intermediates, which are essential building blocks for the synthesis of final drug products. Its presence in these intermediates facilitates the production of a wide range of pharmaceuticals, thereby supporting the development of new treatments and medications.
Safety Precautions:
Due to its potential hazards, 4-ethyl-thiobenzamide should be handled with care. It is important to avoid ingestion, inhalation, or skin absorption to prevent adverse health effects. Additionally, proper storage conditions, such as a cool, dry place away from heat and ignition sources, should be maintained to ensure the stability and safety of the compound.
Check Digit Verification of cas no
The CAS Registry Mumber 57774-76-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,7,7 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 57774-76:
(7*5)+(6*7)+(5*7)+(4*7)+(3*4)+(2*7)+(1*6)=172
172 % 10 = 2
So 57774-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NS/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H2,10,11)
