57796-64-2 Usage
Uses
Used in Pharmaceutical Industry:
5,6-Dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxylic acid is used as a reactant in the preparation of hydroxypyrazines, which are important intermediates in the synthesis of various pharmaceutical compounds. These hydroxypyrazines can be further modified to develop new drugs with potential therapeutic applications, such as anti-inflammatory, analgesic, and antipyretic agents.
Used in Chemical Synthesis:
In the chemical industry, 5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxylic acid can be utilized as a building block for the synthesis of more complex organic molecules. Its unique structure allows for various chemical reactions, such as substitution, addition, and condensation, which can lead to the formation of novel compounds with diverse applications in different fields.
Used in Research and Development:
5,6-Dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxylic acid can also be employed as a research tool in the development of new synthetic methods and strategies. Its reactivity and structural features make it an interesting candidate for exploring new reaction pathways and understanding the underlying mechanisms involved in the formation of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 57796-64-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,7,9 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57796-64:
(7*5)+(6*7)+(5*7)+(4*9)+(3*6)+(2*6)+(1*4)=182
182 % 10 = 2
So 57796-64-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O3/c1-3-4(2)9-6(10)5(8-3)7(11)12/h1-2H3,(H,9,10)(H,11,12)
