578-32-5 Usage
Azobenzene Family
A group of compounds containing a functional structure R-N=N-R'
Fluorogenic Probe
A biological application used for detecting and imaging specific biological molecules through fluorescence
Fluorescence Microscopy
A technique that utilizes the fluorescent properties of compounds like DABTF to visualize cellular and molecular processes
Selective Binding
The ability of DABTF to specifically interact with certain biological molecules, allowing for targeted imaging and detection
Emission of Fluorescence
The process by which DABTF emits light upon illumination, which is crucial for its use in fluorescence microscopy
Environmental Pollutant Detection
The use of DABTF in developing sensors for detecting heavy metal ions and other environmental contaminants
Toxicity
The potential harmful effects of DABTF when ingested or inhaled, necessitating careful handling
Skin and Eye Irritation
The possible adverse effects of DABTF upon contact, emphasizing the importance of proper safety precautions during use
Check Digit Verification of cas no
The CAS Registry Mumber 578-32-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,7 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 578-32:
(5*5)+(4*7)+(3*8)+(2*3)+(1*2)=85
85 % 10 = 5
So 578-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H11F4N3/c1-21(2)14-7-10(17)13(6-11(14)18)20-19-12-5-8(15)3-4-9(12)16/h3-7H,1-2H3/b20-19+
