578007-67-7 Usage
Uses
Used in Chemical Research:
2-Amino-5-iodo-pyridine-3-carbaldehyde is used as a research compound for the study of its chemical properties and potential applications in various fields.
Used in Organic Synthesis:
2-Amino-5-iodo-pyridine-3-carbaldehyde is used as a synthetic intermediate for the production of other complex organic molecules, contributing to the development of new compounds with potential applications in various industries.
Used in Pharmaceutical Industry:
2-Amino-5-iodo-pyridine-3-carbaldehyde is used as a building block in the synthesis of pharmaceutical compounds, potentially leading to the development of new drugs with therapeutic applications.
Used in Material Science:
2-Amino-5-iodo-pyridine-3-carbaldehyde is used as a component in the development of new materials with specific properties, such as in the creation of advanced polymers or other materials with unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 578007-67-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,8,0,0 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 578007-67:
(8*5)+(7*7)+(6*8)+(5*0)+(4*0)+(3*7)+(2*6)+(1*7)=177
177 % 10 = 7
So 578007-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H5IN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-3H,(H2,8,9)
578007-67-7Relevant academic research and scientific papers
NOVEL BRONCHODILATING DIAZAHETEROARYLS
-
Page/Page column 69, (2012/03/08)
The invention relates to novel compounds having the general formula (I), and which compounds are useful to treat a disorder or disease characterized by bronchoconstriction, e.g. COPD and asthma.
NOVEL BRONCHODILATING DIAZAHETEROARYLS
-
Page/Page column 146, (2010/09/17)
The invention relates to novel compounds having the general formula (I), and which compounds are useful to treat a disorder or disease characterized by bronchoconstriction, e.g. COPD and asthma.
