578007-69-9 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-6-IODO-[1,8]NAPHTHYRIDINE-3-CARBONITRILE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs with specific therapeutic properties.
Used in Radiochemistry:
2-AMINO-6-IODO-[1,8]NAPHTHYRIDINE-3-CARBONITRILE is used as a modification agent for radioiodination targets. Its iodine atom makes it suitable for labeling biological molecules, such as proteins or peptides, with radioactive isotopes. This process is essential in diagnostic imaging and therapeutic applications, as it allows for the tracking and visualization of specific biological processes in vivo.
Check Digit Verification of cas no
The CAS Registry Mumber 578007-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,8,0,0 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 578007-69:
(8*5)+(7*7)+(6*8)+(5*0)+(4*0)+(3*7)+(2*6)+(1*9)=179
179 % 10 = 9
So 578007-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H5IN4/c10-7-2-5-1-6(3-11)8(12)14-9(5)13-4-7/h1-2,4H,(H2,12,13,14)
