5793-85-1 Usage
Description
Calcium Phthalate Hydrate, with the chemical formula Ca(C8H4O4)·xH2O and CAS number 5793-85-1, is an organic compound that serves as a nucleating agent in the polymer industry. It is a white crystalline powder that enhances the crystallization process, leading to improved mechanical properties and reduced cycle times in the production of various plastic materials.
Uses
Used in the Plastics Industry:
Calcium Phthalate Hydrate is used as a nucleating agent for improving the performance of polypropylene-based thermoplastic vulcanizates (TPVs). Its addition to the polymer matrix accelerates the crystallization process, resulting in enhanced mechanical properties, such as increased tensile strength and impact resistance. Additionally, it reduces the cycle time during the manufacturing process, leading to increased production efficiency.
Used in the Production of Extruded Plates:
Calcium Phthalate Hydrate is also utilized in the preparation of extruded plates, where it acts as a nucleating agent. Its presence in the polymer matrix promotes faster crystallization, leading to improved dimensional stability and reduced warpage in the final product. This results in extruded plates with better mechanical properties and more consistent quality, making them suitable for various applications, such as in construction, automotive, and packaging industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5793-85-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,9 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5793-85:
(6*5)+(5*7)+(4*9)+(3*3)+(2*8)+(1*5)=131
131 % 10 = 1
So 5793-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H11N5O4/c1-6-11-12(8-4-7(19(21)22)2-3-10(8)20)9(5-15)13(16)23-14(11)18-17-6/h2-4,12,20H,16H2,1H3,(H,17,18)
