57980-07-1 Usage
Uses
Used in Dye Industry:
4-methyl-7-morpholino-2H-pyrano[2,3-b]pyridin-2-one is used as a layer dye for its ability to impart color to different materials. Its unique chemical structure allows it to form stable complexes with various substrates, making it a valuable addition to the dye industry. 4-methyl-7-morpholino-2H-pyrano[2,3-b]pyridin-2-one's coloration properties can be utilized in a wide range of applications, from textiles to plastics, and even in the creation of pigments for artistic purposes.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, the compound's structural similarity to known pharmaceutical agents suggests potential applications in the pharmaceutical industry. 4-methyl-7-morpholino-2H-pyrano[2,3-b]pyridin-2-one could be further investigated for its possible therapeutic effects, such as its potential to interact with biological targets or modulate specific signaling pathways.
Used in Chemical Research:
4-methyl-7-morpholino-2H-pyrano[2,3-b]pyridin-2-one's unique structure and properties also make it a valuable subject for chemical research. Scientists and researchers can study its reactivity, stability, and potential interactions with other molecules, which could lead to the discovery of new chemical reactions or the development of novel materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 57980-07-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,9,8 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 57980-07:
(7*5)+(6*7)+(5*9)+(4*8)+(3*0)+(2*0)+(1*7)=161
161 % 10 = 1
So 57980-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O3/c1-9-8-12(16)18-13-10(9)2-3-11(14-13)15-4-6-17-7-5-15/h2-3,8H,4-7H2,1H3
