58125-01-2 Usage
Uses
Used in Medicinal Chemistry and Biochemistry:
2-(4-Methoxy-phenyl)-acetamidine is utilized as a building block for the synthesis of potential pharmaceutical agents. Its unique structure allows it to be a key component in the development of new drugs with therapeutic effects.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-(4-Methoxy-phenyl)-acetamidine is used as a precursor for the creation of new drugs. Its potential therapeutic effects are being studied for the treatment of various diseases, including cancer and neurodegenerative disorders.
Used in Antimicrobial Agents Development:
2-(4-Methoxy-phenyl)-acetamidine has demonstrated antibacterial and antifungal activities, making it a potential candidate for the development of new antimicrobial agents. This application can contribute to the fight against drug-resistant infections and the discovery of novel treatments for various microbial diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 58125-01-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,2 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 58125-01:
(7*5)+(6*8)+(5*1)+(4*2)+(3*5)+(2*0)+(1*1)=112
112 % 10 = 2
So 58125-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H3,10,11)
