58125-02-3 Usage
Molecular weight
178.23 g/mol
Type of compound
Organic compound
Functional group
Acetamidine (an amidine bonded to an acetamido group)
Usage
Organic synthesis, pharmaceutical research (due to potential biological activities)
Ethoxyphenyl group
Useful in the development of new drugs and pharmaceuticals
Potential applications
Medicinal chemistry (development of new therapeutic agents)
Check Digit Verification of cas no
The CAS Registry Mumber 58125-02-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,2 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 58125-02:
(7*5)+(6*8)+(5*1)+(4*2)+(3*5)+(2*0)+(1*2)=113
113 % 10 = 3
So 58125-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H3,11,12)