58177-53-0 Usage
Uses
Used in Organic Synthesis:
2-Cyano-3-(2-thienyl)acrylic acid is utilized as a key intermediate in organic synthesis, particularly for the production of pharmaceuticals and agrochemicals. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Cyano-3-(2-thienyl)acrylic acid is used as a precursor for the development of new drugs. Its potential biological and pharmacological properties, such as anti-inflammatory and analgesic effects, make it a promising candidate for the treatment of various medical conditions.
Used in Agrochemical Industry:
2-Cyano-3-(2-thienyl)acrylic acid is also employed in the agrochemical industry as a starting material for the synthesis of various agrochemicals, including pesticides and herbicides. Its unique chemical properties contribute to the development of effective and environmentally friendly agricultural products.
Used in Medicine and Biotechnology:
2-Cyano-3-(2-thienyl)acrylic acid serves as a precursor in the preparation of other organic compounds with potential applications in medicine and biotechnology. Its versatility in chemical reactions allows for the development of novel compounds with therapeutic or diagnostic potential, contributing to advancements in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 58177-53-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,7 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 58177-53:
(7*5)+(6*8)+(5*1)+(4*7)+(3*7)+(2*5)+(1*3)=150
150 % 10 = 0
So 58177-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO2S/c9-5-6(8(10)11)4-7-2-1-3-12-7/h1-4H,(H,10,11)/b6-4-
