58210-58-5 Usage
General Description
1,4-(N-2-aminoethyl-2'-pyridyl disulfide)-7-nitrobenzo-2-oxa-1,3-diazole is a fluorescent chemical compound commonly used as a probe in biological and biochemical research. It contains a nitrobenzoxadiazole (NBD) group and a pyridine disulfide group, making it suitable for measuring thiol-containing molecules such as proteins and small molecules. The compound is known for its high sensitivity and selectivity towards thiols, making it a valuable tool for studying redox processes and thiol-mediated signaling pathways in cells. Additionally, due to its fluorescent properties, it can be used for imaging and detection purposes in various biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 58210-58-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,1 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58210-58:
(7*5)+(6*8)+(5*2)+(4*1)+(3*0)+(2*5)+(1*8)=115
115 % 10 = 5
So 58210-58-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N5O3S2/c19-18(20)10-5-4-9(12-13(10)17-21-16-12)14-7-8-22-23-11-3-1-2-6-15-11/h1-6,14H,7-8H2