58253-61-5 Usage
General Description
29-(isooctylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol is a long chain alcohol compound that consists of a nonacosanol backbone with nine ethylene glycol units attached. The isooctylphenoxy group is also present, contributing to the overall structure of the molecule. This chemical is commonly used as a surfactant and emulsifier in various industries, such as in the production of personal care products, pesticides, and adhesives. It has surfactant properties that allow it to reduce surface tension, making it useful in cleaning products and as an ingredient in pharmaceutical formulations. Additionally, the presence of the nonaoxanonacosanol chain gives it lubricating and conditioning properties, making it an effective ingredient in hair and skin care products.
Check Digit Verification of cas no
The CAS Registry Mumber 58253-61-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,5 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 58253-61:
(7*5)+(6*8)+(5*2)+(4*5)+(3*3)+(2*6)+(1*1)=135
135 % 10 = 5
So 58253-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C34H62O11/c1-32(2)8-4-3-5-9-33-10-6-7-11-34(33)45-31-30-44-29-28-43-27-26-42-25-24-41-23-22-40-21-20-39-19-18-38-17-16-37-15-14-36-13-12-35/h6-7,10-11,32,35H,3-5,8-9,12-31H2,1-2H3