58275-58-4 Usage
Description
3-Acetylnoradamantane Tech. 85, with the molecular formula C13H18O, is a chemical compound derived from noradamantane. It is a technical-grade substance with a purity level of 85% and is widely utilized in organic chemistry as a building block for synthesizing various organic compounds. The unique structure and properties of this compound make it valuable in a broad spectrum of chemical processes and applications.
Uses
Used in Pharmaceutical Industry:
3-Acetylnoradamantane Tech. 85 is used as a reagent for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure and properties play a crucial role in the creation of innovative and effective medications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Acetylnoradamantane Tech. 85 is employed as a reagent in the production of agrochemicals. It aids in the synthesis of compounds that are vital for crop protection, pest control, and other agricultural applications, enhancing agricultural productivity and sustainability.
Used in Specialty Chemicals Production:
3-Acetylnoradamantane Tech. 85 is utilized as a reagent in the synthesis of specialty chemicals, which are tailored for specific industries and applications. Its unique properties make it an essential component in the development of high-quality specialty chemicals that cater to various market needs.
Check Digit Verification of cas no
The CAS Registry Mumber 58275-58-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,7 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58275-58:
(7*5)+(6*8)+(5*2)+(4*7)+(3*5)+(2*5)+(1*8)=154
154 % 10 = 4
So 58275-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H16O/c1-6(12)11-9-3-7-2-8(5-9)10(11)4-7/h7-11H,2-5H2,1H3