58281-80-4 Usage
Uses
Used in Pharmaceutical Industry:
METHYL (2S,4R)-4-FLUOROPROLINATE is used as a building block for the synthesis of pharmaceuticals and organic compounds, due to its unique structure and properties that contribute to the development of various drugs and biologically active molecules.
Used in Medicinal Chemistry Research:
METHYL (2S,4R)-4-FLUOROPROLINATE is used as a research compound in medicinal chemistry, where its unique structure and properties are explored for potential applications in drug discovery and development.
Used in Chemical Biology Research:
METHYL (2S,4R)-4-FLUOROPROLINATE is used as a research tool in chemical biology, where its unique structure and properties are studied to understand its interactions with biological systems and its potential role in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 58281-80-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,8 and 1 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 58281-80:
(7*5)+(6*8)+(5*2)+(4*8)+(3*1)+(2*8)+(1*0)=144
144 % 10 = 4
So 58281-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H10FNO2.ClH/c1-10-6(9)5-2-4(7)3-8-5;/h4-5,8H,2-3H2,1H3;1H/t4-,5+;/m1./s1
