58348-14-4 Usage
Uses
Used in Chemical Synthesis:
2,4,5-Trimethylthiophenol is used as an intermediate in the synthesis of various organic compounds, playing a crucial role in the production of pesticides, pharmaceuticals, and fragrance ingredients. Its unique chemical structure allows for the creation of a wide range of products with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4,5-Trimethylthiophenol is used as a building block for the development of new drugs. Its chemical properties make it suitable for the synthesis of various medicinal compounds, contributing to the advancement of healthcare and treatment options.
Used in Pesticide Production:
2,4,5-Trimethylthiophenol is utilized as a key component in the formulation of pesticides. Its chemical properties enable the development of effective pest control agents, helping to protect crops and maintain agricultural productivity.
Used in Fragrance Industry:
In the fragrance industry, 2,4,5-Trimethylthiophenol is employed as a raw material for the creation of various scent compounds. Its unique odor profile contributes to the development of distinct and appealing fragrances for a wide range of applications, including perfumes, cosmetics, and household products.
Used as a Chemical Reagent:
2,4,5-Trimethylthiophenol serves as a chemical reagent in organic synthesis, facilitating various chemical reactions and processes. Its reactivity and stability make it a valuable tool in the laboratory and industrial settings.
Used as a Flavoring Agent in Food Products:
Although it has a strong, unpleasant odor, 2,4,5-Trimethylthiophenol is used as a flavoring agent in certain food products. Its unique taste profile can be modified and combined with other ingredients to create specific flavor profiles, enhancing the sensory experience of food and beverages.
Check Digit Verification of cas no
The CAS Registry Mumber 58348-14-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,3,4 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 58348-14:
(7*5)+(6*8)+(5*3)+(4*4)+(3*8)+(2*1)+(1*4)=144
144 % 10 = 4
So 58348-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12S/c1-6-4-8(3)9(10)5-7(6)2/h4-5,10H,1-3H3
