58386-00-8 Usage
Uses
Used in Organic Synthesis:
(5-methoxy-2-thienyl)thioacetic acid serves as a key intermediate in organic synthesis, where its distinctive structure allows for the creation of various complex organic molecules. Its reactivity and functional groups make it a versatile building block for synthesizing a wide range of compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (5-methoxy-2-thienyl)thioacetic acid is utilized as a precursor for the development of pharmaceuticals. Its unique chemical properties may contribute to the design of novel drugs with specific therapeutic effects, potentially leading to advancements in the treatment of various diseases and conditions.
Used in Pharmaceutical Development:
(5-methoxy-2-thienyl)thioacetic acid is employed as a starting material in the synthesis of new pharmaceuticals. Its incorporation into drug molecules can enhance their efficacy, selectivity, and pharmacokinetic properties, making it a valuable asset in the development of innovative therapeutic agents.
Used in Research and Development:
(5-methoxy-2-thienyl)thioacetic acid is also used in research and development settings to explore its potential applications and effects. Ongoing studies aim to uncover its full potential, which may lead to the discovery of new uses and the creation of more effective products in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 58386-00-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,3,8 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 58386-00:
(7*5)+(6*8)+(5*3)+(4*8)+(3*6)+(2*0)+(1*0)=148
148 % 10 = 8
So 58386-00-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O3S2/c1-10-6-2-3-7(12-6)11-4-5(8)9/h2-3H,4H2,1H3,(H,8,9)
