58419-69-5

Usage

Uses

Used in Pharmaceutical Research and Development:
1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE is used as a research chemical for the development of new drugs and pharmacological studies. Its unique chemical structure makes it a valuable candidate for exploring its potential in medicinal chemistry, particularly for the synthesis of novel therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE is used as a building block or intermediate in the synthesis of various pharmaceutical compounds. Its specific functional groups can be exploited to create new molecules with potential therapeutic applications.
Used in Drug Design:
1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE is utilized in drug design to create new chemical entities with improved pharmacological properties. Its structural features can be modified to enhance drug-target interactions, selectivity, and efficacy.
Used in Chemical Synthesis:
In chemical synthesis, 1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE is used as a reagent or precursor in the preparation of other organic compounds. Its versatility in chemical reactions allows for the creation of a wide range of products for various applications.
Used in Analytical Chemistry:
1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE can be employed in analytical chemistry as a standard or reference compound for the development and validation of analytical methods, such as chromatography, spectroscopy, and other techniques.
Used in Material Science:
In material science, 1-[4-(BROMOMETHYL)PHENYL]-1H-1,2,4-TRIAZOLE 0.5 HYDROBROMIDE may be investigated for its potential use in the development of new materials with specific properties, such as conductivity, stability, or reactivity.

InChI:InChI=1/C9H8BrN3/c10-5-8-1-3-9(4-2-8)13-7-11-6-12-13/h1-4,6-7H,5H2