58457-37-7 Usage
General Description
1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid is a chemical compound with a unique bicyclic structure. It is a carboxylic acid derivative and belongs to the class of pyrroloquinoline compounds. 1H-PYRROLO[3,2-H]QUINOLINE-2-CARBOXYLIC ACID has potential pharmaceutical applications due to its ability to interact with biological systems. It has been studied for its anti-inflammatory, anti-tumor, and anti-bacterial properties. Additionally, it can act as a chemoattractant in immune response and has been investigated as a potential drug for treating various diseases. Its chemical structure and properties make it an interesting target for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 58457-37-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,4,5 and 7 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58457-37:
(7*5)+(6*8)+(5*4)+(4*5)+(3*7)+(2*3)+(1*7)=157
157 % 10 = 7
So 58457-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O2/c15-12(16)9-6-8-4-3-7-2-1-5-13-10(7)11(8)14-9/h1-6,14H,(H,15,16)
