585-23-9 Usage
Uses
Used in Pharmaceutical Industry:
3-[(aminocarbonyl)amino]alanine is used as a building block for the design and synthesis of new peptide-based drugs and bioactive compounds. Its unique structure allows for the development of innovative therapeutic agents with potential applications in the treatment of various diseases.
Used in Catalyst and Enzyme Inhibitor Development:
3-[(aminocarbonyl)amino]alanine is used in the development of peptide-based catalysts and enzyme inhibitors. Its unique chemical properties make it a promising candidate for the creation of new catalysts and inhibitors that can improve the efficiency and selectivity of chemical reactions and biological processes.
Used in Therapeutic Applications:
3-[(aminocarbonyl)amino]alanine is used in the treatment of various diseases, such as cancer and infectious diseases. Its potential therapeutic applications are currently being investigated, and it may offer new avenues for the development of effective treatments for these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 585-23-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,8 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 585-23:
(5*5)+(4*8)+(3*5)+(2*2)+(1*3)=79
79 % 10 = 9
So 585-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H9N3O3/c5-2(1-3(8)9)7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m0/s1
