58505-91-2 Usage
Synthetic derivative of pyrrolidine
The compound is derived from pyrrolidine, a heterocyclic organic compound, which means it is a modified version of the original compound.
Carboxylic acid group
The presence of a carboxylic acid group (-COOH) in the structure contributes to the compound's acidic properties and makes it suitable for forming salts and esters.
Oxo group
The presence of an oxo group (C=O) in the structure indicates the presence of a carbon-oxygen double bond, which influences the compound's reactivity and properties.
Pharmaceutical research and development
1-octyl-5-oxopyrrolidine-3-carboxylic acid is commonly used as a building block in the synthesis of novel drug candidates, making it valuable in the pharmaceutical industry.
Unique structure and properties
The compound's structure and properties make it a valuable intermediate in the production of various pharmaceuticals and biologically active molecules.
Medicinal chemistry and drug discovery
The compound has potential applications in the field of medicinal chemistry and drug discovery due to its ability to modulate biological processes and target specific pathways in the human body.
Check Digit Verification of cas no
The CAS Registry Mumber 58505-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,5,0 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 58505-91:
(7*5)+(6*8)+(5*5)+(4*0)+(3*5)+(2*9)+(1*1)=142
142 % 10 = 2
So 58505-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H23NO3/c1-2-3-4-5-6-7-8-14-10-11(13(16)17)9-12(14)15/h11H,2-10H2,1H3,(H,16,17)
