5853-83-8 Usage
Uses
Used in Pharmaceutical Industry:
(2S)-6-amino-2-[[(3S)-3-amino-4-hydroxy-4-oxobutanoyl]amino]hexanoic acid is used as an active pharmaceutical ingredient for the development of drugs targeting specific metabolic pathways and protein synthesis mechanisms. Its unique structure allows for potential therapeutic applications in treating various diseases and conditions related to protein metabolism.
Used in Nutritional Supplements:
As a dipeptide, (2S)-6-amino-2-[[(3S)-3-amino-4-hydroxy-4-oxobutanoyl]amino]hexanoic acid can be used in nutritional supplements to enhance protein synthesis and support overall metabolic health. Its potential to improve athletic performance and muscle recovery makes it a valuable addition to sports nutrition products.
Used in Research and Development:
(2S)-6-amino-2-[[(3S)-3-amino-4-hydroxy-4-oxobutanoyl]amino]hexanoic acid serves as a valuable research tool for studying the mechanisms of protein biosynthesis and metabolic processes. Its unique structure and functional groups make it an ideal candidate for investigating the interactions between amino acids and other biomolecules in various biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 5853-83-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,5 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5853-83:
(6*5)+(5*8)+(4*5)+(3*3)+(2*8)+(1*3)=118
118 % 10 = 8
So 5853-83-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H19N3O5/c11-6(9(15)16)3-1-2-4-13-8(14)5-7(12)10(17)18/h6-7H,1-5,11-12H2,(H,13,14)(H,15,16)(H,17,18)/t6-,7-/m0/s1
