5855-89-0 Usage
General Description
1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol is a chemical compound with a complex molecular structure. It is a derivative of benzo[h]quinoline and contains a diol functional group at positions 3 and 7. 1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol has potential pharmaceutical applications, as it has been investigated for its antiviral and antioxidant properties. Additionally, it has been studied for its potential use in the treatment of neurodegenerative diseases. The complex structure of 1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol indicates its potential versatility in various biological and pharmaceutical applications, making it a subject of interest for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 5855-89-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,5 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5855-89:
(6*5)+(5*8)+(4*5)+(3*5)+(2*8)+(1*9)=130
130 % 10 = 0
So 5855-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2/c15-9-6-8-4-5-10-11(13(8)14-7-9)2-1-3-12(10)16/h1-5,9,14-16H,6-7H2