5855-89-0 Usage
Uses
Used in Pharmaceutical Applications:
1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol is used as a potential antiviral agent due to its ability to combat viral infections, making it a candidate for further research and development in this area.
Additionally, it is used as an antioxidant, which helps in protecting cells from damage caused by reactive oxygen species, thereby contributing to the prevention of various diseases associated with oxidative stress.
Furthermore, 1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol is being studied for its potential role in the treatment of neurodegenerative diseases, given its possible impact on the underlying mechanisms of such conditions.
The complex structure of 1,2,3,4-tetrahydrobenzo[h]quinoline-3,7-diol suggests its potential versatility in various biological and pharmaceutical applications, warranting continued research and development to fully explore its capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 5855-89-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,5 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5855-89:
(6*5)+(5*8)+(4*5)+(3*5)+(2*8)+(1*9)=130
130 % 10 = 0
So 5855-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2/c15-9-6-8-4-5-10-11(13(8)14-7-9)2-1-3-12(10)16/h1-5,9,14-16H,6-7H2
