58560-28-4 Usage
Uses
Used in Organic Synthesis:
DIETHYL L-2-ISOTHIOCYANTOGLUTARATE is used as a reagent for incorporating sulfur into organic molecules, which is essential for the preparation of complex chemical structures. Its isothiocyanate functional group allows for versatile chemical reactions, making it a key component in the synthesis of various organic compounds.
Used in Chemical Research:
In the realm of chemical research, DIETHYL L-2-ISOTHIOCYANTOGLUTARATE is utilized as a reagent to study the properties and reactions of sulfur-containing organic molecules. Its unique structure provides researchers with insights into the behavior of sulfur in different chemical environments, furthering the understanding of sulfur chemistry.
Used in Biochemical Material Formation:
DIETHYL L-2-ISOTHIOCYANTOGLUTARATE is employed as a reagent in the formation of various biochemical materials, such as peptides, proteins, and other biomolecules. Its ability to incorporate sulfur into these structures allows for the development of novel bioactive compounds with potential applications in medicine, agriculture, and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 58560-28-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,5,6 and 0 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58560-28:
(7*5)+(6*8)+(5*5)+(4*6)+(3*0)+(2*2)+(1*8)=144
144 % 10 = 4
So 58560-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO4S/c1-3-14-9(12)6-5-8(11-7-16)10(13)15-4-2/h8H,3-6H2,1-2H3/t8-/m0/s1
