58713-31-8

Usage

InChI:InChI=1/C12H15NO2/c14-12(13-10-6-4-5-7-10)15-11-8-2-1-3-9-11/h1-3,8-10H,4-7H2,(H,13,14)

Upstream product

• 1885-14-9 phenyl chloroformate 
• 1003-03-8 Cyclopentamine 

Downstream Products

• 84942-55-2 O-phenyl N-cyclopentyl-N-isocyanato-carbonyl-carbamate 
• 1010409-03-6 C₂₂H₃₀FN₅O₄ 

Relevant academic research and scientific papers

Synthesis and evaluation of novel dimethylpyridazine derivatives as hedgehog signaling pathway inhibitors

We report herein the design and synthesis of a series of structural modified dimethylpyridazine compounds as novel hedgehog signaling pathway inhibitors. The bicyclic phthalazine core and 4-methylamino-piperidine moiety of Taladegib were replaced with dim

AZAARENE DERIVATIVES

A compound represented by the general formula: wherein X1 represents a nitrogen atom or a group represented by the formula -CR10=; X2 represents a nitrogen atom or a group represented by the formula -CR11=; Y represents an oxygen atom or the like; R1 represents a C1-6 alkoxy group, an optionally substituted C6-10 aryloxy group, a group represented by the formula -NR12aR12b or the like; R2 represents a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like; R3, R4, R5, R6, R7, R8, R10 and R11 each independently represent a hydrogen atom, a halogen atom, an optionally substituted C1-6 alkyl group, or the like; R9 represents a group represented by the formula -NR16aR16b or the like; and R12a, R12b, R16a and R16b each independently represent a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like, a salt thereof, or a hydrate of the foregoing.