5874-86-2 Usage
General Description
H-ALA-D-ALA-ALA-OH is a tripeptide composed of three amino acids, with the chemical structure H-(A)-D-(A)-A-OH, where A represents alanine and D represents D-alanine. This molecule is a precursor for the synthesis of peptidoglycan, an essential component of bacterial cell walls. The presence of D-alanine in the sequence makes the molecule resistant to degradation by proteases, making it important for the stability and integrity of the bacterial cell wall. H-ALA-D-ALA-ALA-OH plays a crucial role in the development of potential antibiotics that target bacterial cell walls, making it an important molecule in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 5874-86-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,7 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5874-86:
(6*5)+(5*8)+(4*7)+(3*4)+(2*8)+(1*6)=132
132 % 10 = 2
So 5874-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H17N3O4/c1-4(10)7(13)11-5(2)8(14)12-6(3)9(15)16/h4-6H,10H2,1-3H3,(H,11,13)(H,12,14)(H,15,16)/t4?,5-,6?/m1/s1
