58763-67-0 Usage
Uses
Used in Organic Synthesis:
EED is utilized as a building block in the production of a wide range of compounds, including pharmaceutical drugs, agrochemicals, and specialty chemicals. Its long hydrocarbon chain and alkyne functionality contribute to its versatility in organic synthesis, allowing for the creation of diverse molecular structures.
Used in Chemical Reactions:
As a reagent, EED is employed in various chemical reactions such as alkyne metathesis and cross-coupling reactions. Its reactivity enables the formation of new carbon-carbon bonds, which are crucial in the synthesis of complex organic molecules.
Used in Materials Science:
EED's unique chemical structure and reactivity also make it a promising candidate for applications in the field of materials science. Its properties could be harnessed to develop new materials with specific characteristics, such as improved mechanical strength or novel electronic properties.
Used in Nanotechnology:
The potential applications of EED extend to the field of nanotechnology, where its chemical properties could be exploited to create nanoscale structures or materials with enhanced performance in various applications, including electronics, medicine, and energy storage.
Check Digit Verification of cas no
The CAS Registry Mumber 58763-67-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,7,6 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58763-67:
(7*5)+(6*8)+(5*7)+(4*6)+(3*3)+(2*6)+(1*7)=170
170 % 10 = 0
So 58763-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H28O2/c1-4-6-7-8-9-10-11-12-13-14-15-18-16(3)17-5-2/h8-9,16H,4-5,10-15H2,1-3H3/b9-8+
