588680-01-7 Usage
Uses
Used in Pharmaceutical Industry:
AKOS B015238 is used as an intermediate in the synthesis of various drugs for the pharmaceutical industry. Its unique chemical structure allows it to be a key component in the development of new medications.
Used in Organic Chemistry:
AKOS B015238 is also used in the field of organic chemistry for various applications, such as the synthesis of other organic compounds and the development of new chemical reactions. Its versatility as a chemical intermediate makes it a valuable asset in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 588680-01-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,8,8,6,8 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 588680-01:
(8*5)+(7*8)+(6*8)+(5*6)+(4*8)+(3*0)+(2*0)+(1*1)=207
207 % 10 = 7
So 588680-01-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClN2O2/c1-6-3-4-8(11)9(5-6)15-7(2)10(14)13-12/h3-5,7H,12H2,1-2H3,(H,13,14)
