588681-52-1 Usage
Uses
Used in Pharmaceutical Industry:
2-[(2-CHLORO-4-FLUOROBENZYL)OXY]BENZALDEHYDE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure, featuring a chlorine and fluorine atom in the benzyl group, allows for the development of new drugs with specific therapeutic properties. 2-[(2-CHLORO-4-FLUOROBENZYL)OXY]BENZALDEHYDE can be further modified or used as a building block to create novel pharmaceutical agents with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, 2-[(2-CHLORO-4-FLUOROBENZYL)OXY]BENZALDEHYDE is utilized as a precursor for the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical structure can be tailored to target specific pests or weeds, leading to the development of more effective and environmentally friendly agrochemicals. 2-[(2-CHLORO-4-FLUOROBENZYL)OXY]BENZALDEHYDE's versatility in synthesis allows for the creation of a wide range of agrochemical products with varying modes of action and selectivity.
Used in Organic Synthesis:
2-[(2-CHLORO-4-FLUOROBENZYL)OXY]BENZALDEHYDE is also used as a versatile building block in organic synthesis. Its unique structure allows for various chemical reactions, such as oxidation, reduction, and substitution, to be performed on the benzaldehyde moiety or the benzyl group. This enables the synthesis of a wide range of organic compounds with diverse applications, including specialty chemicals, dyes, and materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 588681-52-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,8,8,6,8 and 1 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 588681-52:
(8*5)+(7*8)+(6*8)+(5*6)+(4*8)+(3*1)+(2*5)+(1*2)=221
221 % 10 = 1
So 588681-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H10ClFO2/c15-13-7-12(16)6-5-11(13)9-18-14-4-2-1-3-10(14)8-17/h1-8H,9H2
