588687-34-7 Usage
Aromatic properties
The compound has a benzene ring in its structure This property makes it useful in various chemical reactions and contributes to its stability.
Reactivity
2-[(2-fluorobenzyl)oxy]-3-methoxybenzaldehyde can undergo various chemical reactions This quality makes it suitable for use in the synthesis of pharmaceuticals and other organic compounds.
Benzaldehyde group
The compound contains a benzaldehyde functional group This group is responsible for its aldehyde properties and contributes to its reactivity.
Methoxy group attachment
A methoxy group (-OCH3) is attached to the benzene ring This group imparts additional reactivity and influences the compound's chemical properties.
Fluorobenzyl group attachment
A fluorobenzyl group (-C6H4F) is attached to the benzene ring The presence of this group makes the compound useful in drug design and organic chemistry research due to its unique properties.
Use in pharmaceuticals
The compound is commonly used in the synthesis of pharmaceuticals Its aromatic properties and reactivity make it a valuable building block in drug development.
Use in organic chemistry research
2-[(2-fluorobenzyl)oxy]-3-methoxybenzaldehyde is useful for research in organic chemistry Its unique structure and reactivity allow for the exploration of new chemical reactions and synthesis methods.
Check Digit Verification of cas no
The CAS Registry Mumber 588687-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,8,8,6,8 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 588687-34:
(8*5)+(7*8)+(6*8)+(5*6)+(4*8)+(3*7)+(2*3)+(1*4)=237
237 % 10 = 7
So 588687-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H13FO3/c1-18-14-8-4-6-11(9-17)15(14)19-10-12-5-2-3-7-13(12)16/h2-9H,10H2,1H3
