588720-53-0 Usage
Uses
Used in Chemical Research:
Pyrrolo[1,2-a]pyrazine-3-carboxylic acid (9CI) is used as a research compound for its unique structure and properties. It is valuable in the field of chemistry for understanding the behavior of polycyclic aromatic compounds and their potential applications in various chemical processes.
Used in Pharmaceutical Development:
Pyrrolo[1,2-a]pyrazine-3-carboxylic acid (9CI) is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure may contribute to the development of new drugs with potential therapeutic applications.
Used in Material Science:
Pyrrolo[1,2-a]pyrazine-3-carboxylic acid (9CI) is used as a component in the development of new materials with specific properties, such as electronic, optical, or mechanical characteristics, which could be applied in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 588720-53-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,8,8,7,2 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 588720-53:
(8*5)+(7*8)+(6*8)+(5*7)+(4*2)+(3*0)+(2*5)+(1*3)=200
200 % 10 = 0
So 588720-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2/c11-8(12)7-5-10-3-1-2-6(10)4-9-7/h1-5H,(H,11,12)
